C18H17N5O2 — CID 141324902
2-[[1-(2-anilino-2-oxoethyl)triazol-4-yl]methyl]benzamide (PubChem CID 141324902) has the molecular formula C18H17N5O2 and a molecular weight of 335.37 g/mol. Its IUPAC name is 2-[[1-(2-anilino-2-oxoethyl)triazol-4-yl]methyl]benzamide.
| Compound Name | 2-[[1-(2-anilino-2-oxoethyl)triazol-4-yl]methyl]benzamide |
|---|---|
| PubChem CID | 141324902 |
| Molecular Formula | C18H17N5O2 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 2-[[1-(2-anilino-2-oxoethyl)triazol-4-yl]methyl]benzamide |
| SMILES | NC(=O)c1ccccc1Cc1cn(CC(=O)Nc2ccccc2)nn1 |
| InChI | InChI=1S/C18H17N5O2/c19-18(25)16-9-5-4-6-13(16)10-15-11-23(22-21-15)12-17(24)20-14-7-2-1-3-8-14/h1-9,11H,10,12H2,(H2,19,25)(H,20,24) |
| InChIKey | BTLQBWIOKWSLCW-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |