C19H17N5O4 — CID 155814179
2-[[2-[4-[(4-formylphenoxy)methyl]triazol-1-yl]acetyl]amino]benzamide (PubChem CID 155814179) has the molecular formula C19H17N5O4 and a molecular weight of 379.38 g/mol. Its IUPAC name is 2-[[2-[4-[(4-formylphenoxy)methyl]triazol-1-yl]acetyl]amino]benzamide.
| Compound Name | 2-[[2-[4-[(4-formylphenoxy)methyl]triazol-1-yl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 155814179 |
| Molecular Formula | C19H17N5O4 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 2-[[2-[4-[(4-formylphenoxy)methyl]triazol-1-yl]acetyl]amino]benzamide |
| SMILES | NC(=O)c1ccccc1NC(=O)Cn1cc(COc2ccc(C=O)cc2)nn1 |
| InChI | InChI=1S/C19H17N5O4/c20-19(27)16-3-1-2-4-17(16)21-18(26)10-24-9-14(22-23-24)12-28-15-7-5-13(11-25)6-8-15/h1-9,11H,10,12H2,(H2,20,27)(H,21,26) |
| InChIKey | JQPWWPUONUGVPV-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 129.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|