C16H15NO2 — CID 141326664
3-[methoxy(phenyl)methylidene]-3a,4-dihydro-1H-indol-2-one (PubChem CID 141326664) has the molecular formula C16H15NO2 and a molecular weight of 253.30 g/mol. Its IUPAC name is 3-[methoxy(phenyl)methylidene]-3a,4-dihydro-1H-indol-2-one.
| Compound Name | 3-[methoxy(phenyl)methylidene]-3a,4-dihydro-1H-indol-2-one |
|---|---|
| PubChem CID | 141326664 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 3-[methoxy(phenyl)methylidene]-3a,4-dihydro-1H-indol-2-one |
| SMILES | COC(=C1C(=O)NC2=CC=CCC21)c1ccccc1 |
| InChI | InChI=1S/C16H15NO2/c1-19-15(11-7-3-2-4-8-11)14-12-9-5-6-10-13(12)17-16(14)18/h2-8,10,12H,9H2,1H3,(H,17,18) |
| InChIKey | AOMVNKFCSPUPCC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|