C16H15N3 — CID 141327802
7-[(E)-2-phenylbut-1-enyl]-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 141327802) has the molecular formula C16H15N3 and a molecular weight of 249.32 g/mol. Its IUPAC name is 7-[(E)-2-phenylbut-1-enyl]-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 7-[(E)-2-phenylbut-1-enyl]-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 141327802 |
| Molecular Formula | C16H15N3 |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 7-[(E)-2-phenylbut-1-enyl]-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | CC/C(=C\c1ccn2ncnc2c1)c1ccccc1 |
| InChI | InChI=1S/C16H15N3/c1-2-14(15-6-4-3-5-7-15)10-13-8-9-19-16(11-13)17-12-18-19/h3-12H,2H2,1H3/b14-10+ |
| InChIKey | LJPHWGMZJYUJJT-GXDHUFHOSA-N |
| XLogP | 3.68 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |