C22H21N5O2 — CID 162637575
(E)-1-[(3aS,6aS)-4-([1,2,4]triazolo[1,5-a]pyridine-7-carbonyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-3-phenylprop-2-en-1-one (PubChem CID 162637575) has the molecular formula C22H21N5O2 and a molecular weight of 387.44 g/mol. Its IUPAC name is (E)-1-[(3aS,6aS)-4-([1,2,4]triazolo[1,5-a]pyridine-7-carbonyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[(3aS,6aS)-4-([1,2,4]triazolo[1,5-a]pyridine-7-carbonyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 162637575 |
| Molecular Formula | C22H21N5O2 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | (E)-1-[(3aS,6aS)-4-([1,2,4]triazolo[1,5-a]pyridine-7-carbonyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-3-phenylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccc1)N1CC[C@H]2[C@@H]1CCN2C(=O)c1ccn2ncnc2c1 |
| InChI | InChI=1S/C22H21N5O2/c28-21(7-6-16-4-2-1-3-5-16)25-11-9-19-18(25)10-12-26(19)22(29)17-8-13-27-20(14-17)23-15-24-27/h1-8,13-15,18-19H,9-12H2/b7-6+/t18-,19-/m0/s1 |
| InChIKey | PRDIBVQZZYOHFS-FNYRVFDFSA-N |
| XLogP | 2.26 |
| TPSA | 70.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|