C22H23ClN2O2 — CID 171156677
1-[(3aS,6aS)-1-[(2-chloro-3-hydroxyphenyl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-3-phenylprop-2-en-1-one (PubChem CID 171156677) has the molecular formula C22H23ClN2O2 and a molecular weight of 382.89 g/mol. Its IUPAC name is 1-[(3aS,6aS)-1-[(2-chloro-3-hydroxyphenyl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-3-phenylprop-2-en-1-one.
| Compound Name | 1-[(3aS,6aS)-1-[(2-chloro-3-hydroxyphenyl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 171156677 |
| Molecular Formula | C22H23ClN2O2 |
| Molecular Weight | 382.89 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 1-[(3aS,6aS)-1-[(2-chloro-3-hydroxyphenyl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-3-phenylprop-2-en-1-one |
| SMILES | O=C(C=Cc1ccccc1)N1CC[C@H]2[C@@H]1CCN2Cc1cccc(O)c1Cl |
| InChI | InChI=1S/C22H23ClN2O2/c23-22-17(7-4-8-20(22)26)15-24-13-11-19-18(24)12-14-25(19)21(27)10-9-16-5-2-1-3-6-16/h1-10,18-19,26H,11-15H2/t18-,19-/m0/s1 |
| InChIKey | URGPQHWINLDXFL-OALUTQOASA-N |
| XLogP | 3.93 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.89 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|