C25H16Cl2OS2 — CID 141329084
1,5-bis(4-chlorophenyl)-2,4-dithiophen-2-ylpenta-1,4-dien-3-one (PubChem CID 141329084) has the molecular formula C25H16Cl2OS2 and a molecular weight of 467.44 g/mol. Its IUPAC name is 1,5-bis(4-chlorophenyl)-2,4-dithiophen-2-ylpenta-1,4-dien-3-one.
| Compound Name | 1,5-bis(4-chlorophenyl)-2,4-dithiophen-2-ylpenta-1,4-dien-3-one |
|---|---|
| PubChem CID | 141329084 |
| Molecular Formula | C25H16Cl2OS2 |
| Molecular Weight | 467.44 g/mol |
| Exact Mass | 466.00 |
| IUPAC Name | 1,5-bis(4-chlorophenyl)-2,4-dithiophen-2-ylpenta-1,4-dien-3-one |
| SMILES | O=C(C(=Cc1ccc(Cl)cc1)c1cccs1)C(=Cc1ccc(Cl)cc1)c1cccs1 |
| InChI | InChI=1S/C25H16Cl2OS2/c26-19-9-5-17(6-10-19)15-21(23-3-1-13-29-23)25(28)22(24-4-2-14-30-24)16-18-7-11-20(27)12-8-18/h1-16H |
| InChIKey | ADGGFBRGULXJFJ-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.44 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|