C9H14N2OS — CID 141330968
1-propyl-2-sulfanyl-2H-pyridine-3-carboxamide (PubChem CID 141330968) has the molecular formula C9H14N2OS and a molecular weight of 198.29 g/mol. Its IUPAC name is 1-propyl-2-sulfanyl-2H-pyridine-3-carboxamide.
| Compound Name | 1-propyl-2-sulfanyl-2H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 141330968 |
| Molecular Formula | C9H14N2OS |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 1-propyl-2-sulfanyl-2H-pyridine-3-carboxamide |
| SMILES | CCCN1C=CC=C(C(N)=O)C1S |
| InChI | InChI=1S/C9H14N2OS/c1-2-5-11-6-3-4-7(8(10)12)9(11)13/h3-4,6,9,13H,2,5H2,1H3,(H2,10,12) |
| InChIKey | KOYARKRCKSVXCB-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|