C39H22N2OS3 — CID 141332082
6-(1-benzofuran-2-yl)-4,5-bis(1-benzothiophen-2-yl)-2-(1H-indol-2-yl)-1,3-benzothiazole (PubChem CID 141332082) has the molecular formula C39H22N2OS3 and a molecular weight of 630.82 g/mol. Its IUPAC name is 6-(1-benzofuran-2-yl)-4,5-bis(1-benzothiophen-2-yl)-2-(1H-indol-2-yl)-1,3-benzothiazole.
| Compound Name | 6-(1-benzofuran-2-yl)-4,5-bis(1-benzothiophen-2-yl)-2-(1H-indol-2-yl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 141332082 |
| Molecular Formula | C39H22N2OS3 |
| Molecular Weight | 630.82 g/mol |
| Exact Mass | 630.09 |
| IUPAC Name | 6-(1-benzofuran-2-yl)-4,5-bis(1-benzothiophen-2-yl)-2-(1H-indol-2-yl)-1,3-benzothiazole |
| SMILES | c1ccc2[nH]c(-c3nc4c(-c5cc6ccccc6s5)c(-c5cc6ccccc6s5)c(-c5cc6ccccc6o5)cc4s3)cc2c1 |
| InChI | InChI=1S/C39H22N2OS3/c1-5-13-27-22(9-1)17-28(40-27)39-41-38-35(45-39)21-26(30-18-23-10-2-6-14-29(23)42-30)36(33-19-24-11-3-7-15-31(24)43-33)37(38)34-20-25-12-4-8-16-32(25)44-34/h1-21,40H |
| InChIKey | OUJOGUFMBNOZQY-UHFFFAOYSA-N |
| XLogP | 12.62 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.82 |
| LogP ≤ 5 | 12.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |