C13H18N2 — CID 141332969
3-methyl-3-(2-phenylethyl)-1,2-dihydropyrrol-5-amine (PubChem CID 141332969) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 3-methyl-3-(2-phenylethyl)-1,2-dihydropyrrol-5-amine.
| Compound Name | 3-methyl-3-(2-phenylethyl)-1,2-dihydropyrrol-5-amine |
|---|---|
| PubChem CID | 141332969 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 3-methyl-3-(2-phenylethyl)-1,2-dihydropyrrol-5-amine |
| SMILES | CC1(CCc2ccccc2)C=C(N)NC1 |
| InChI | InChI=1S/C13H18N2/c1-13(9-12(14)15-10-13)8-7-11-5-3-2-4-6-11/h2-6,9,15H,7-8,10,14H2,1H3 |
| InChIKey | ZDWLWVWMQYTKNO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |