C14H19ClN2 — CID 141332997
(3S)-3-[2-(3-chlorophenyl)butyl]-2,3-dihydro-1H-pyrrol-5-amine (PubChem CID 141332997) has the molecular formula C14H19ClN2 and a molecular weight of 250.77 g/mol. Its IUPAC name is (3S)-3-[2-(3-chlorophenyl)butyl]-2,3-dihydro-1H-pyrrol-5-amine.
| Compound Name | (3S)-3-[2-(3-chlorophenyl)butyl]-2,3-dihydro-1H-pyrrol-5-amine |
|---|---|
| PubChem CID | 141332997 |
| Molecular Formula | C14H19ClN2 |
| Molecular Weight | 250.77 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | (3S)-3-[2-(3-chlorophenyl)butyl]-2,3-dihydro-1H-pyrrol-5-amine |
| SMILES | CCC(C[C@H]1C=C(N)NC1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H19ClN2/c1-2-11(6-10-7-14(16)17-9-10)12-4-3-5-13(15)8-12/h3-5,7-8,10-11,17H,2,6,9,16H2,1H3/t10-,11?/m0/s1 |
| InChIKey | VGZQUQIUDUEAOG-VUWPPUDQSA-N |
| XLogP | 3.24 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.77 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |