About butanoate;methyl-bis(prop-2-enyl)azanium
butanoate;methyl-bis(prop-2-enyl)azanium (PubChem CID 141333460) has the molecular formula C11H21NO2
and a molecular weight of 199.29 g/mol. Its IUPAC name is butanoate;methyl-bis(prop-2-enyl)azanium.
Molecular Properties
| Compound Name | butanoate;methyl-bis(prop-2-enyl)azanium |
| PubChem CID | 141333460 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | butanoate;methyl-bis(prop-2-enyl)azanium |
| SMILES | C=CC[NH+](C)CC=C.CCCC(=O)[O-] |
| InChI | InChI=1S/C7H13N.C4H8O2/c1-4-6-8(3)7-5-2;1-2-3-4(5)6/h4-5H,1-2,6-7H2,3H3;2-3H2,1H3,(H,5,6) |
| InChIKey | JPOOYSBJCHLDMN-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 44.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze butanoate;methyl-bis(prop-2-enyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanoate;methyl-bis(prop-2-enyl)azanium?
The IUPAC name of butanoate;methyl-bis(prop-2-enyl)azanium (CID 141333460) is butanoate;methyl-bis(prop-2-enyl)azanium.
What is the SMILES notation for butanoate;methyl-bis(prop-2-enyl)azanium?
The canonical SMILES for butanoate;methyl-bis(prop-2-enyl)azanium is C=CC[NH+](C)CC=C.CCCC(=O)[O-].
What is the InChIKey of butanoate;methyl-bis(prop-2-enyl)azanium?
The InChIKey is JPOOYSBJCHLDMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N.C4H8O2/c1-4-6-8(3)7-5-2;1-2-3-4(5)6/h4-5H,1-2,6-7H2,3H3;2-3H2,1H3,(H,5,6).
What are the key properties of butanoate;methyl-bis(prop-2-enyl)azanium?
butanoate;methyl-bis(prop-2-enyl)azanium has a molecular weight of 199.29 g/mol, XLogP of -0.59, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butanoate;methyl-bis(prop-2-enyl)azanium is sourced from PubChem (CID 141333460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).