About but-3-enoate;triethylazanium
but-3-enoate;triethylazanium (PubChem CID 142665490) has the molecular formula C10H21NO2
and a molecular weight of 187.28 g/mol. Its IUPAC name is but-3-enoate;triethylazanium.
Molecular Properties
| Compound Name | but-3-enoate;triethylazanium |
| PubChem CID | 142665490 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | but-3-enoate;triethylazanium |
| SMILES | C=CCC(=O)[O-].CC[NH+](CC)CC |
| InChI | InChI=1S/C6H15N.C4H6O2/c1-4-7(5-2)6-3;1-2-3-4(5)6/h4-6H2,1-3H3;2H,1,3H2,(H,5,6) |
| InChIKey | SPDCZXKKVISXDY-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 44.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze but-3-enoate;triethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-enoate;triethylazanium?
The IUPAC name of but-3-enoate;triethylazanium (CID 142665490) is but-3-enoate;triethylazanium.
What is the SMILES notation for but-3-enoate;triethylazanium?
The canonical SMILES for but-3-enoate;triethylazanium is C=CCC(=O)[O-].CC[NH+](CC)CC.
What is the InChIKey of but-3-enoate;triethylazanium?
The InChIKey is SPDCZXKKVISXDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.C4H6O2/c1-4-7(5-2)6-3;1-2-3-4(5)6/h4-6H2,1-3H3;2H,1,3H2,(H,5,6).
What are the key properties of but-3-enoate;triethylazanium?
but-3-enoate;triethylazanium has a molecular weight of 187.28 g/mol, XLogP of -0.76, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-enoate;triethylazanium is sourced from PubChem (CID 142665490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).