C24H22ClN5O3S3 — CID 141333872
N-[2-(carbamothioylamino)ethyl]-1-(2-chlorophenyl)-5-[5-(3-methylsulfonylphenyl)thiophen-2-yl]pyrazole-3-carboxamide (PubChem CID 141333872) has the molecular formula C24H22ClN5O3S3 and a molecular weight of 560.13 g/mol. Its IUPAC name is N-[2-(carbamothioylamino)ethyl]-1-(2-chlorophenyl)-5-[5-(3-methylsulfonylphenyl)thiophen-2-yl]pyrazole-3-carboxamide.
| Compound Name | N-[2-(carbamothioylamino)ethyl]-1-(2-chlorophenyl)-5-[5-(3-methylsulfonylphenyl)thiophen-2-yl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 141333872 |
| Molecular Formula | C24H22ClN5O3S3 |
| Molecular Weight | 560.13 g/mol |
| Exact Mass | 559.06 |
| IUPAC Name | N-[2-(carbamothioylamino)ethyl]-1-(2-chlorophenyl)-5-[5-(3-methylsulfonylphenyl)thiophen-2-yl]pyrazole-3-carboxamide |
| SMILES | CS(=O)(=O)c1cccc(-c2ccc(-c3cc(C(=O)NCCNC(N)=S)nn3-c3ccccc3Cl)s2)c1 |
| InChI | InChI=1S/C24H22ClN5O3S3/c1-36(32,33)16-6-4-5-15(13-16)21-9-10-22(35-21)20-14-18(23(31)27-11-12-28-24(26)34)29-30(20)19-8-3-2-7-17(19)25/h2-10,13-14H,11-12H2,1H3,(H,27,31)(H3,26,28,34) |
| InChIKey | JVFFYZHMDXOKBC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 119.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.13 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|