C23H17ClF3N3O2S3 — CID 59633057
1-(2-chlorophenyl)-5-[5-(3-methylsulfonylphenyl)thiophen-2-yl]-N-(2,2,2-trifluoroethyl)pyrazole-3-carbothioamide (PubChem CID 59633057) has the molecular formula C23H17ClF3N3O2S3 and a molecular weight of 556.06 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-5-[5-(3-methylsulfonylphenyl)thiophen-2-yl]-N-(2,2,2-trifluoroethyl)pyrazole-3-carbothioamide.
| Compound Name | 1-(2-chlorophenyl)-5-[5-(3-methylsulfonylphenyl)thiophen-2-yl]-N-(2,2,2-trifluoroethyl)pyrazole-3-carbothioamide |
|---|---|
| PubChem CID | 59633057 |
| Molecular Formula | C23H17ClF3N3O2S3 |
| Molecular Weight | 556.06 g/mol |
| Exact Mass | 555.01 |
| IUPAC Name | 1-(2-chlorophenyl)-5-[5-(3-methylsulfonylphenyl)thiophen-2-yl]-N-(2,2,2-trifluoroethyl)pyrazole-3-carbothioamide |
| SMILES | CS(=O)(=O)c1cccc(-c2ccc(-c3cc(C(=S)NCC(F)(F)F)nn3-c3ccccc3Cl)s2)c1 |
| InChI | InChI=1S/C23H17ClF3N3O2S3/c1-35(31,32)15-6-4-5-14(11-15)20-9-10-21(34-20)19-12-17(22(33)28-13-23(25,26)27)29-30(19)18-8-3-2-7-16(18)24/h2-12H,13H2,1H3,(H,28,33) |
| InChIKey | DQFPMQUPZGQCET-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.06 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|