C27H42O5 — CID 141334433
(5R,10R,13R,14S,17R)-14-hydroxy-10,13-dimethyl-17-[(3R)-2,3,6-trihydroxy-6-methylheptan-2-yl]-4,5,9,11,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-6-one (PubChem CID 141334433) has the molecular formula C27H42O5 and a molecular weight of 446.63 g/mol. Its IUPAC name is (5R,10R,13R,14S,17R)-14-hydroxy-10,13-dimethyl-17-[(3R)-2,3,6-trihydroxy-6-methylheptan-2-yl]-4,5,9,11,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-6-one.
| Compound Name | (5R,10R,13R,14S,17R)-14-hydroxy-10,13-dimethyl-17-[(3R)-2,3,6-trihydroxy-6-methylheptan-2-yl]-4,5,9,11,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-6-one |
|---|---|
| PubChem CID | 141334433 |
| Molecular Formula | C27H42O5 |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.30 |
| IUPAC Name | (5R,10R,13R,14S,17R)-14-hydroxy-10,13-dimethyl-17-[(3R)-2,3,6-trihydroxy-6-methylheptan-2-yl]-4,5,9,11,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-6-one |
| SMILES | CC(C)(O)CC[C@@H](O)C(C)(O)[C@@H]1CC[C@@]2(O)C3=CC(=O)[C@@H]4CC=CC[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C27H42O5/c1-23(2,30)13-11-22(29)26(5,31)21-10-15-27(32)19-16-20(28)18-8-6-7-12-24(18,3)17(19)9-14-25(21,27)4/h6-7,16-18,21-22,29-32H,8-15H2,1-5H3/t17?,18-,21+,22+,24+,25+,26?,27+/m0/s1 |
| InChIKey | WTRBZLVGDOPBSM-CWIGYAPQSA-N |
| XLogP | 3.69 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|