C27H40O5 — CID 69497690
(14S)-17-[(2R)-2,6-dihydroxy-6-methyl-3-oxoheptan-2-yl]-14-hydroxy-10,13-dimethyl-4,5,9,11,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-6-one (PubChem CID 69497690) has the molecular formula C27H40O5 and a molecular weight of 444.61 g/mol. Its IUPAC name is (14S)-17-[(2R)-2,6-dihydroxy-6-methyl-3-oxoheptan-2-yl]-14-hydroxy-10,13-dimethyl-4,5,9,11,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-6-one.
| Compound Name | (14S)-17-[(2R)-2,6-dihydroxy-6-methyl-3-oxoheptan-2-yl]-14-hydroxy-10,13-dimethyl-4,5,9,11,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-6-one |
|---|---|
| PubChem CID | 69497690 |
| Molecular Formula | C27H40O5 |
| Molecular Weight | 444.61 g/mol |
| Exact Mass | 444.29 |
| IUPAC Name | (14S)-17-[(2R)-2,6-dihydroxy-6-methyl-3-oxoheptan-2-yl]-14-hydroxy-10,13-dimethyl-4,5,9,11,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-6-one |
| SMILES | CC(C)(O)CCC(=O)[C@](C)(O)C1CC[C@@]2(O)C3=CC(=O)C4CC=CCC4(C)C3CCC12C |
| InChI | InChI=1S/C27H40O5/c1-23(2,30)13-11-22(29)26(5,31)21-10-15-27(32)19-16-20(28)18-8-6-7-12-24(18,3)17(19)9-14-25(21,27)4/h6-7,16-18,21,30-32H,8-15H2,1-5H3/t17?,18?,21?,24?,25?,26-,27-/m1/s1 |
| InChIKey | LYWKYWMYZFIWQQ-JUGDUVMKSA-N |
| XLogP | 3.90 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.61 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|