C13H18O8 — CID 14133450
[(2R,3S)-2,3-diacetyloxy-3-[(2R)-5-oxooxolan-2-yl]propyl] acetate (PubChem CID 14133450) has the molecular formula C13H18O8 and a molecular weight of 302.28 g/mol. Its IUPAC name is [(2R,3S)-2,3-diacetyloxy-3-[(2R)-5-oxooxolan-2-yl]propyl] acetate.
| Compound Name | [(2R,3S)-2,3-diacetyloxy-3-[(2R)-5-oxooxolan-2-yl]propyl] acetate |
|---|---|
| PubChem CID | 14133450 |
| Molecular Formula | C13H18O8 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | [(2R,3S)-2,3-diacetyloxy-3-[(2R)-5-oxooxolan-2-yl]propyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1CCC(=O)O1 |
| InChI | InChI=1S/C13H18O8/c1-7(14)18-6-11(19-8(2)15)13(20-9(3)16)10-4-5-12(17)21-10/h10-11,13H,4-6H2,1-3H3/t10-,11-,13+/m1/s1 |
| InChIKey | NRFXSLPSTKBSDT-WZRBSPASSA-N |
| XLogP | 0.12 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|