C16H23FN2O3 — CID 141335283
(3R,4S)-4-(benzylamino)-3-(3-fluoropropoxy)piperidine-1-carboxylic acid (PubChem CID 141335283) has the molecular formula C16H23FN2O3 and a molecular weight of 310.37 g/mol. Its IUPAC name is (3R,4S)-4-(benzylamino)-3-(3-fluoropropoxy)piperidine-1-carboxylic acid.
| Compound Name | (3R,4S)-4-(benzylamino)-3-(3-fluoropropoxy)piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 141335283 |
| Molecular Formula | C16H23FN2O3 |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | (3R,4S)-4-(benzylamino)-3-(3-fluoropropoxy)piperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CC[C@H](NCc2ccccc2)[C@H](OCCCF)C1 |
| InChI | InChI=1S/C16H23FN2O3/c17-8-4-10-22-15-12-19(16(20)21)9-7-14(15)18-11-13-5-2-1-3-6-13/h1-3,5-6,14-15,18H,4,7-12H2,(H,20,21)/t14-,15+/m0/s1 |
| InChIKey | KGBUDYOIPTWIPE-LSDHHAIUSA-N |
| XLogP | 2.27 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|