C12H16N2O4S — CID 69113749
3-(benzylsulfamoyl)pyrrolidine-1-carboxylic acid (PubChem CID 69113749) has the molecular formula C12H16N2O4S and a molecular weight of 284.34 g/mol. Its IUPAC name is 3-(benzylsulfamoyl)pyrrolidine-1-carboxylic acid.
| Compound Name | 3-(benzylsulfamoyl)pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 69113749 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 3-(benzylsulfamoyl)pyrrolidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCC(S(=O)(=O)NCc2ccccc2)C1 |
| InChI | InChI=1S/C12H16N2O4S/c15-12(16)14-7-6-11(9-14)19(17,18)13-8-10-4-2-1-3-5-10/h1-5,11,13H,6-9H2,(H,15,16) |
| InChIKey | CWWVDXILJUCJML-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |