C19H15NO4S — CID 141336447
N-methyl-2,2-dioxo-N-(pyren-1-ylmethyl)-1,3,2-dioxathietan-4-amine (PubChem CID 141336447) has the molecular formula C19H15NO4S and a molecular weight of 353.40 g/mol. Its IUPAC name is N-methyl-2,2-dioxo-N-(pyren-1-ylmethyl)-1,3,2-dioxathietan-4-amine.
| Compound Name | N-methyl-2,2-dioxo-N-(pyren-1-ylmethyl)-1,3,2-dioxathietan-4-amine |
|---|---|
| PubChem CID | 141336447 |
| Molecular Formula | C19H15NO4S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | N-methyl-2,2-dioxo-N-(pyren-1-ylmethyl)-1,3,2-dioxathietan-4-amine |
| SMILES | CN(Cc1ccc2ccc3cccc4ccc1c2c34)C1OS(=O)(=O)O1 |
| InChI | InChI=1S/C19H15NO4S/c1-20(19-23-25(21,22)24-19)11-15-8-7-14-6-5-12-3-2-4-13-9-10-16(15)18(14)17(12)13/h2-10,19H,11H2,1H3 |
| InChIKey | RTSNGEUXZDCLDQ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|