C26H24N4O — CID 141336856
2-[4-[4-(1,3-dihydroisoindol-2-yl)benzoyl]piperazin-1-yl]benzonitrile (PubChem CID 141336856) has the molecular formula C26H24N4O and a molecular weight of 408.51 g/mol. Its IUPAC name is 2-[4-[4-(1,3-dihydroisoindol-2-yl)benzoyl]piperazin-1-yl]benzonitrile.
| Compound Name | 2-[4-[4-(1,3-dihydroisoindol-2-yl)benzoyl]piperazin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 141336856 |
| Molecular Formula | C26H24N4O |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 2-[4-[4-(1,3-dihydroisoindol-2-yl)benzoyl]piperazin-1-yl]benzonitrile |
| SMILES | N#Cc1ccccc1N1CCN(C(=O)c2ccc(N3Cc4ccccc4C3)cc2)CC1 |
| InChI | InChI=1S/C26H24N4O/c27-17-21-5-3-4-8-25(21)28-13-15-29(16-14-28)26(31)20-9-11-24(12-10-20)30-18-22-6-1-2-7-23(22)19-30/h1-12H,13-16,18-19H2 |
| InChIKey | VFQIOFLCGBWALE-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 50.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |