C25H31N3O2 — CID 141337922
1-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-hexyl-3-phenylurea (PubChem CID 141337922) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is 1-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-hexyl-3-phenylurea.
| Compound Name | 1-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-hexyl-3-phenylurea |
|---|---|
| PubChem CID | 141337922 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | 1-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-hexyl-3-phenylurea |
| SMILES | CCCCCCN(Cc1cc2ccc(C)c(C)c2[nH]c1=O)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C25H31N3O2/c1-4-5-6-10-15-28(25(30)26-22-11-8-7-9-12-22)17-21-16-20-14-13-18(2)19(3)23(20)27-24(21)29/h7-9,11-14,16H,4-6,10,15,17H2,1-3H3,(H,26,30)(H,27,29) |
| InChIKey | KAFXEVNZGYCSAH-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|