C18H16NOP — CID 141338071
N,N-diphenyl-2-phosphanyloxyaniline (PubChem CID 141338071) has the molecular formula C18H16NOP and a molecular weight of 293.31 g/mol. Its IUPAC name is N,N-diphenyl-2-phosphanyloxyaniline.
| Compound Name | N,N-diphenyl-2-phosphanyloxyaniline |
|---|---|
| PubChem CID | 141338071 |
| Molecular Formula | C18H16NOP |
| Molecular Weight | 293.31 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | N,N-diphenyl-2-phosphanyloxyaniline |
| SMILES | POc1ccccc1N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H16NOP/c21-20-18-14-8-7-13-17(18)19(15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-14H,21H2 |
| InChIKey | BHCQPKVIKGVCOF-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.31 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|