C15H12N4O4S — CID 141338384
5-hydroxy-2-[[3-(3-methoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]pyran-4-one (PubChem CID 141338384) has the molecular formula C15H12N4O4S and a molecular weight of 344.35 g/mol. Its IUPAC name is 5-hydroxy-2-[[3-(3-methoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]pyran-4-one.
| Compound Name | 5-hydroxy-2-[[3-(3-methoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]pyran-4-one |
|---|---|
| PubChem CID | 141338384 |
| Molecular Formula | C15H12N4O4S |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | 5-hydroxy-2-[[3-(3-methoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]pyran-4-one |
| SMILES | COc1cccc(-c2n[nH]c(=S)n2N=Cc2cc(=O)c(O)co2)c1 |
| InChI | InChI=1S/C15H12N4O4S/c1-22-10-4-2-3-9(5-10)14-17-18-15(24)19(14)16-7-11-6-12(20)13(21)8-23-11/h2-8,21H,1H3,(H,18,24) |
| InChIKey | SANPASNMWJPQNR-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|