C14H9BrN4O3S — CID 141338387
2-[[3-(3-bromophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]-5-hydroxypyran-4-one (PubChem CID 141338387) has the molecular formula C14H9BrN4O3S and a molecular weight of 393.22 g/mol. Its IUPAC name is 2-[[3-(3-bromophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]-5-hydroxypyran-4-one.
| Compound Name | 2-[[3-(3-bromophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]-5-hydroxypyran-4-one |
|---|---|
| PubChem CID | 141338387 |
| Molecular Formula | C14H9BrN4O3S |
| Molecular Weight | 393.22 g/mol |
| Exact Mass | 391.96 |
| IUPAC Name | 2-[[3-(3-bromophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]-5-hydroxypyran-4-one |
| SMILES | O=c1cc(C=Nn2c(-c3cccc(Br)c3)n[nH]c2=S)occ1O |
| InChI | InChI=1S/C14H9BrN4O3S/c15-9-3-1-2-8(4-9)13-17-18-14(23)19(13)16-6-10-5-11(20)12(21)7-22-10/h1-7,21H,(H,18,23) |
| InChIKey | SULBFABBUIOBTL-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 96.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.22 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|