C14H10BrN5OS2 — CID 9359139
4-[(Z)-[2-(3-bromophenyl)-1,3-thiazol-4-yl]methylideneamino]-6-methyl-3-sulfanylidene-2H-1,2,4-triazin-5-one (PubChem CID 9359139) has the molecular formula C14H10BrN5OS2 and a molecular weight of 408.31 g/mol. Its IUPAC name is 4-[(Z)-[2-(3-bromophenyl)-1,3-thiazol-4-yl]methylideneamino]-6-methyl-3-sulfanylidene-2H-1,2,4-triazin-5-one.
| Compound Name | 4-[(Z)-[2-(3-bromophenyl)-1,3-thiazol-4-yl]methylideneamino]-6-methyl-3-sulfanylidene-2H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 9359139 |
| Molecular Formula | C14H10BrN5OS2 |
| Molecular Weight | 408.31 g/mol |
| Exact Mass | 406.95 |
| IUPAC Name | 4-[(Z)-[2-(3-bromophenyl)-1,3-thiazol-4-yl]methylideneamino]-6-methyl-3-sulfanylidene-2H-1,2,4-triazin-5-one |
| SMILES | Cc1n[nH]c(=S)n(/N=C\c2csc(-c3cccc(Br)c3)n2)c1=O |
| InChI | InChI=1S/C14H10BrN5OS2/c1-8-13(21)20(14(22)19-18-8)16-6-11-7-23-12(17-11)9-3-2-4-10(15)5-9/h2-7H,1H3,(H,19,22)/b16-6- |
| InChIKey | PQDLGMXMNSAAKA-SOFYXZRVSA-N |
| XLogP | 3.38 |
| TPSA | 75.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.31 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|