C20H28N4O — CID 141338525
[4-[(1-methylindol-7-yl)methyl]piperazin-1-yl]-[(2S)-1-methylpyrrolidin-2-yl]methanone (PubChem CID 141338525) has the molecular formula C20H28N4O and a molecular weight of 340.47 g/mol. Its IUPAC name is [4-[(1-methylindol-7-yl)methyl]piperazin-1-yl]-[(2S)-1-methylpyrrolidin-2-yl]methanone.
| Compound Name | [4-[(1-methylindol-7-yl)methyl]piperazin-1-yl]-[(2S)-1-methylpyrrolidin-2-yl]methanone |
|---|---|
| PubChem CID | 141338525 |
| Molecular Formula | C20H28N4O |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | [4-[(1-methylindol-7-yl)methyl]piperazin-1-yl]-[(2S)-1-methylpyrrolidin-2-yl]methanone |
| SMILES | CN1CCC[C@H]1C(=O)N1CCN(Cc2cccc3ccn(C)c23)CC1 |
| InChI | InChI=1S/C20H28N4O/c1-21-9-4-7-18(21)20(25)24-13-11-23(12-14-24)15-17-6-3-5-16-8-10-22(2)19(16)17/h3,5-6,8,10,18H,4,7,9,11-15H2,1-2H3/t18-/m0/s1 |
| InChIKey | QLBHZQJSVDTMEX-SFHVURJKSA-N |
| XLogP | 1.92 |
| TPSA | 31.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |