C34H31F2N3O8 — CID 141343743
7-[4-[2-(5,6-dihydroxy-4-oxo-2-phenylchromen-7-yl)oxyethyl]-3-methylpiperazin-1-yl]-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid (PubChem CID 141343743) has the molecular formula C34H31F2N3O8 and a molecular weight of 647.63 g/mol. Its IUPAC name is 7-[4-[2-(5,6-dihydroxy-4-oxo-2-phenylchromen-7-yl)oxyethyl]-3-methylpiperazin-1-yl]-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 7-[4-[2-(5,6-dihydroxy-4-oxo-2-phenylchromen-7-yl)oxyethyl]-3-methylpiperazin-1-yl]-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 141343743 |
| Molecular Formula | C34H31F2N3O8 |
| Molecular Weight | 647.63 g/mol |
| Exact Mass | 647.21 |
| IUPAC Name | 7-[4-[2-(5,6-dihydroxy-4-oxo-2-phenylchromen-7-yl)oxyethyl]-3-methylpiperazin-1-yl]-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid |
| SMILES | CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCN(CCOc4cc5oc(-c6ccccc6)cc(=O)c5c(O)c4O)C(C)C3)c(F)c21 |
| InChI | InChI=1S/C34H31F2N3O8/c1-3-37-17-21(34(44)45)31(41)20-13-22(35)30(28(36)29(20)37)39-10-9-38(18(2)16-39)11-12-46-26-15-25-27(33(43)32(26)42)23(40)14-24(47-25)19-7-5-4-6-8-19/h4-8,13-15,17-18,42-43H,3,9-12,16H2,1-2H3,(H,44,45) |
| InChIKey | CRFJTQHIUOMCBY-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 145.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.63 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|