C18H19F3N2O5S — CID 141344451
methyl 3-(2-methylpiperidin-1-yl)-2-(trifluoromethylsulfonyloxy)quinoline-6-carboxylate (PubChem CID 141344451) has the molecular formula C18H19F3N2O5S and a molecular weight of 432.42 g/mol. Its IUPAC name is methyl 3-(2-methylpiperidin-1-yl)-2-(trifluoromethylsulfonyloxy)quinoline-6-carboxylate.
| Compound Name | methyl 3-(2-methylpiperidin-1-yl)-2-(trifluoromethylsulfonyloxy)quinoline-6-carboxylate |
|---|---|
| PubChem CID | 141344451 |
| Molecular Formula | C18H19F3N2O5S |
| Molecular Weight | 432.42 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | methyl 3-(2-methylpiperidin-1-yl)-2-(trifluoromethylsulfonyloxy)quinoline-6-carboxylate |
| SMILES | COC(=O)c1ccc2nc(OS(=O)(=O)C(F)(F)F)c(N3CCCCC3C)cc2c1 |
| InChI | InChI=1S/C18H19F3N2O5S/c1-11-5-3-4-8-23(11)15-10-13-9-12(17(24)27-2)6-7-14(13)22-16(15)28-29(25,26)18(19,20)21/h6-7,9-11H,3-5,8H2,1-2H3 |
| InChIKey | VUVOJGQXIWOZQZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.42 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|