C16H10F6O3 — CID 141346430
[2-hydroxy-1,2-bis[4-(trifluoromethyl)phenyl]ethylidene]-oxidooxidanium (PubChem CID 141346430) has the molecular formula C16H10F6O3 and a molecular weight of 364.24 g/mol. Its IUPAC name is [2-hydroxy-1,2-bis[4-(trifluoromethyl)phenyl]ethylidene]-oxidooxidanium.
| Compound Name | [2-hydroxy-1,2-bis[4-(trifluoromethyl)phenyl]ethylidene]-oxidooxidanium |
|---|---|
| PubChem CID | 141346430 |
| Molecular Formula | C16H10F6O3 |
| Molecular Weight | 364.24 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | [2-hydroxy-1,2-bis[4-(trifluoromethyl)phenyl]ethylidene]-oxidooxidanium |
| SMILES | [O-]/[O+]=C(/c1ccc(C(F)(F)F)cc1)C(O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H10F6O3/c17-15(18,19)11-5-1-9(2-6-11)13(23)14(25-24)10-3-7-12(8-4-10)16(20,21)22/h1-8,13,23H |
| InChIKey | WTVJVHHZKVLTFS-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 54.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.24 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|