C12H10N4O2S — CID 141347023
5-(3-methylsulfonylphenyl)-1H-pyrazolo[4,3-d]pyrimidine (PubChem CID 141347023) has the molecular formula C12H10N4O2S and a molecular weight of 274.31 g/mol. Its IUPAC name is 5-(3-methylsulfonylphenyl)-1H-pyrazolo[4,3-d]pyrimidine.
| Compound Name | 5-(3-methylsulfonylphenyl)-1H-pyrazolo[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 141347023 |
| Molecular Formula | C12H10N4O2S |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 5-(3-methylsulfonylphenyl)-1H-pyrazolo[4,3-d]pyrimidine |
| SMILES | CS(=O)(=O)c1cccc(-c2ncc3[nH]ncc3n2)c1 |
| InChI | InChI=1S/C12H10N4O2S/c1-19(17,18)9-4-2-3-8(5-9)12-13-6-11-10(15-12)7-14-16-11/h2-7H,1H3,(H,14,16) |
| InChIKey | CXZOLPLIHJBYIB-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |