C10H8F3N3O2S — CID 167938781
3-(3-methylsulfonylphenyl)-5-(trifluoromethyl)-1H-1,2,4-triazole (PubChem CID 167938781) has the molecular formula C10H8F3N3O2S and a molecular weight of 291.25 g/mol. Its IUPAC name is 3-(3-methylsulfonylphenyl)-5-(trifluoromethyl)-1H-1,2,4-triazole.
| Compound Name | 3-(3-methylsulfonylphenyl)-5-(trifluoromethyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 167938781 |
| Molecular Formula | C10H8F3N3O2S |
| Molecular Weight | 291.25 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | 3-(3-methylsulfonylphenyl)-5-(trifluoromethyl)-1H-1,2,4-triazole |
| SMILES | CS(=O)(=O)c1cccc(-c2n[nH]c(C(F)(F)F)n2)c1 |
| InChI | InChI=1S/C10H8F3N3O2S/c1-19(17,18)7-4-2-3-6(5-7)8-14-9(16-15-8)10(11,12)13/h2-5H,1H3,(H,14,15,16) |
| InChIKey | RLERVRUOKOBEIA-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.25 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |