About 1-(methylamino)ethyl quinoline-7-carboxylate
1-(methylamino)ethyl quinoline-7-carboxylate (PubChem CID 141347103) has the molecular formula C13H14N2O2
and a molecular weight of 230.27 g/mol. Its IUPAC name is 1-(methylamino)ethyl quinoline-7-carboxylate.
Molecular Properties
| Compound Name | 1-(methylamino)ethyl quinoline-7-carboxylate |
| PubChem CID | 141347103 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 1-(methylamino)ethyl quinoline-7-carboxylate |
| SMILES | CNC(C)OC(=O)c1ccc2cccnc2c1 |
| InChI | InChI=1S/C13H14N2O2/c1-9(14-2)17-13(16)11-6-5-10-4-3-7-15-12(10)8-11/h3-9,14H,1-2H3 |
| InChIKey | SJUCVEUUKWNHDX-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(methylamino)ethyl quinoline-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(methylamino)ethyl quinoline-7-carboxylate?
The IUPAC name of 1-(methylamino)ethyl quinoline-7-carboxylate (CID 141347103) is 1-(methylamino)ethyl quinoline-7-carboxylate.
What is the SMILES notation for 1-(methylamino)ethyl quinoline-7-carboxylate?
The canonical SMILES for 1-(methylamino)ethyl quinoline-7-carboxylate is CNC(C)OC(=O)c1ccc2cccnc2c1.
What is the InChIKey of 1-(methylamino)ethyl quinoline-7-carboxylate?
The InChIKey is SJUCVEUUKWNHDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O2/c1-9(14-2)17-13(16)11-6-5-10-4-3-7-15-12(10)8-11/h3-9,14H,1-2H3.
What are the key properties of 1-(methylamino)ethyl quinoline-7-carboxylate?
1-(methylamino)ethyl quinoline-7-carboxylate has a molecular weight of 230.27 g/mol, XLogP of 1.96, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(methylamino)ethyl quinoline-7-carboxylate is sourced from PubChem (CID 141347103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).