C24H28N2O — CID 141347591
1-[(1R)-1-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-4-phenyl-2H-pyridine (PubChem CID 141347591) has the molecular formula C24H28N2O and a molecular weight of 360.50 g/mol. Its IUPAC name is 1-[(1R)-1-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-4-phenyl-2H-pyridine.
| Compound Name | 1-[(1R)-1-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-4-phenyl-2H-pyridine |
|---|---|
| PubChem CID | 141347591 |
| Molecular Formula | C24H28N2O |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 1-[(1R)-1-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-4-phenyl-2H-pyridine |
| SMILES | COc1cccc([C@H](CN2CCCC2)N2C=CC(c3ccccc3)=CC2)c1 |
| InChI | InChI=1S/C24H28N2O/c1-27-23-11-7-10-22(18-23)24(19-25-14-5-6-15-25)26-16-12-21(13-17-26)20-8-3-2-4-9-20/h2-4,7-13,16,18,24H,5-6,14-15,17,19H2,1H3/t24-/m0/s1 |
| InChIKey | RXHLMYLBJKDGNH-DEOSSOPVSA-N |
| XLogP | 4.74 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |