C16H22N2O — CID 141349143
3-ethyl-8-methylspiro[1H-quinazoline-2,1'-cyclohexane]-4-one (PubChem CID 141349143) has the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. Its IUPAC name is 3-ethyl-8-methylspiro[1H-quinazoline-2,1'-cyclohexane]-4-one.
| Compound Name | 3-ethyl-8-methylspiro[1H-quinazoline-2,1'-cyclohexane]-4-one |
|---|---|
| PubChem CID | 141349143 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 3-ethyl-8-methylspiro[1H-quinazoline-2,1'-cyclohexane]-4-one |
| SMILES | CCN1C(=O)c2cccc(C)c2NC12CCCCC2 |
| InChI | InChI=1S/C16H22N2O/c1-3-18-15(19)13-9-7-8-12(2)14(13)17-16(18)10-5-4-6-11-16/h7-9,17H,3-6,10-11H2,1-2H3 |
| InChIKey | CDIKMYMJDAGNIT-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |