C17H27NO2 — CID 141350221
1-amino-1-[3-(cycloheptylmethoxy)phenyl]propan-1-ol (PubChem CID 141350221) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is 1-amino-1-[3-(cycloheptylmethoxy)phenyl]propan-1-ol.
| Compound Name | 1-amino-1-[3-(cycloheptylmethoxy)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 141350221 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | 1-amino-1-[3-(cycloheptylmethoxy)phenyl]propan-1-ol |
| SMILES | CCC(N)(O)c1cccc(OCC2CCCCCC2)c1 |
| InChI | InChI=1S/C17H27NO2/c1-2-17(18,19)15-10-7-11-16(12-15)20-13-14-8-5-3-4-6-9-14/h7,10-12,14,19H,2-6,8-9,13,18H2,1H3 |
| InChIKey | MQMSCAFVPSUCBK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|