C18H20NO4- — CID 141351271
(1S,9R,10R)-4-acetyl-6-hydroxy-17-oxido-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-14-one (PubChem CID 141351271) has the molecular formula C18H20NO4- and a molecular weight of 314.36 g/mol. Its IUPAC name is (1S,9R,10R)-4-acetyl-6-hydroxy-17-oxido-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-14-one.
| Compound Name | (1S,9R,10R)-4-acetyl-6-hydroxy-17-oxido-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-14-one |
|---|---|
| PubChem CID | 141351271 |
| Molecular Formula | C18H20NO4- |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | (1S,9R,10R)-4-acetyl-6-hydroxy-17-oxido-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-14-one |
| SMILES | CC(=O)c1cc(O)c2c(c1)[C@]13CCN([O-])[C@H](C2)[C@@H]1CCCC3=O |
| InChI | InChI=1S/C18H20NO4/c1-10(20)11-7-14-12(16(21)8-11)9-15-13-3-2-4-17(22)18(13,14)5-6-19(15)23/h7-8,13,15,21H,2-6,9H2,1H3/q-1/t13-,15+,18-/m0/s1 |
| InChIKey | WEHGPUYTESOWDM-JOQOYGCGSA-N |
| XLogP | 2.33 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |