C25H27N2O7- — CID 87258849
N-[(4R,4aR,7S,7aR,12bS)-10,11-dihydroxy-3-oxido-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3,4-dimethoxybenzamide (PubChem CID 87258849) has the molecular formula C25H27N2O7- and a molecular weight of 467.50 g/mol. Its IUPAC name is N-[(4R,4aR,7S,7aR,12bS)-10,11-dihydroxy-3-oxido-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3,4-dimethoxybenzamide.
| Compound Name | N-[(4R,4aR,7S,7aR,12bS)-10,11-dihydroxy-3-oxido-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 87258849 |
| Molecular Formula | C25H27N2O7- |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | N-[(4R,4aR,7S,7aR,12bS)-10,11-dihydroxy-3-oxido-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)N[C@H]2CC[C@H]3[C@H]4Cc5c(O)c(O)cc6c5[C@@]3(CCN4[O-])[C@H]2O6)cc1OC |
| InChI | InChI=1S/C25H27N2O7/c1-32-18-6-3-12(9-19(18)33-2)24(30)26-15-5-4-14-16-10-13-21-20(11-17(28)22(13)29)34-23(15)25(14,21)7-8-27(16)31/h3,6,9,11,14-16,23,28-29H,4-5,7-8,10H2,1-2H3,(H,26,30)/q-1/t14-,15-,16+,23-,25-/m0/s1 |
| InChIKey | DNELQZWHLHUXKE-PKRQQIIYSA-N |
| XLogP | 2.45 |
| TPSA | 123.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|