C25H19FN4O2 — CID 141352076
(5S)-3-(3,6-dihydro-2H-pyran-4-yl)-7-(2-fluoro-3-pyridinyl)spiro[chromeno[2,3-c]pyridine-5,5'-pyrrole]-2'-amine (PubChem CID 141352076) has the molecular formula C25H19FN4O2 and a molecular weight of 426.45 g/mol. Its IUPAC name is (5S)-3-(3,6-dihydro-2H-pyran-4-yl)-7-(2-fluoro-3-pyridinyl)spiro[chromeno[2,3-c]pyridine-5,5'-pyrrole]-2'-amine.
| Compound Name | (5S)-3-(3,6-dihydro-2H-pyran-4-yl)-7-(2-fluoro-3-pyridinyl)spiro[chromeno[2,3-c]pyridine-5,5'-pyrrole]-2'-amine |
|---|---|
| PubChem CID | 141352076 |
| Molecular Formula | C25H19FN4O2 |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | (5S)-3-(3,6-dihydro-2H-pyran-4-yl)-7-(2-fluoro-3-pyridinyl)spiro[chromeno[2,3-c]pyridine-5,5'-pyrrole]-2'-amine |
| SMILES | NC1=N[C@@]2(C=C1)c1cc(-c3cccnc3F)ccc1Oc1cnc(C3=CCOCC3)cc12 |
| InChI | InChI=1S/C25H19FN4O2/c26-24-17(2-1-9-28-24)16-3-4-21-18(12-16)25(8-5-23(27)30-25)19-13-20(29-14-22(19)32-21)15-6-10-31-11-7-15/h1-6,8-9,12-14H,7,10-11H2,(H2,27,30)/t25-/m0/s1 |
| InChIKey | NUWAKWBKFCVWLW-VWLOTQADSA-N |
| XLogP | 4.36 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|