C48H30N4O2 — CID 141352511
2-[6-[(3Z,5Z,7Z)-azocin-2-yl]-2-(1H-benzimidazol-2-yl)-3,4-bis(1-benzofuran-2-yl)phenyl]-1H-benzo[g]indole (PubChem CID 141352511) has the molecular formula C48H30N4O2 and a molecular weight of 694.79 g/mol. Its IUPAC name is 2-[6-[(3Z,5Z,7Z)-azocin-2-yl]-2-(1H-benzimidazol-2-yl)-3,4-bis(1-benzofuran-2-yl)phenyl]-1H-benzo[g]indole.
| Compound Name | 2-[6-[(3Z,5Z,7Z)-azocin-2-yl]-2-(1H-benzimidazol-2-yl)-3,4-bis(1-benzofuran-2-yl)phenyl]-1H-benzo[g]indole |
|---|---|
| PubChem CID | 141352511 |
| Molecular Formula | C48H30N4O2 |
| Molecular Weight | 694.79 g/mol |
| Exact Mass | 694.24 |
| IUPAC Name | 2-[6-[(3Z,5Z,7Z)-azocin-2-yl]-2-(1H-benzimidazol-2-yl)-3,4-bis(1-benzofuran-2-yl)phenyl]-1H-benzo[g]indole |
| SMILES | C1=C\C=C/C(c2cc(-c3cc4ccccc4o3)c(-c3cc4ccccc4o3)c(-c3nc4ccccc4[nH]3)c2-c2cc3ccc4ccccc4c3[nH]2)=N\C=C/1 |
| InChI | InChI=1S/C48H30N4O2/c1-2-12-24-49-36(17-3-1)34-28-35(42-26-30-14-5-10-20-40(30)53-42)45(43-27-31-15-6-11-21-41(31)54-43)46(48-51-37-18-8-9-19-38(37)52-48)44(34)39-25-32-23-22-29-13-4-7-16-33(29)47(32)50-39/h1-28,50H,(H,51,52)/b2-1-,3-1-,12-2-,17-3-,24-12-,36-17-,49-24-,49-36+ |
| InChIKey | XCWSFAOTOOABFD-PVLBUFGXSA-N |
| XLogP | 12.79 |
| TPSA | 83.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.79 |
| LogP ≤ 5 | 12.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |