C26H21N5O — CID 3007937
4-[5-[4-[6-(4,5-dihydro-1H-imidazol-2-yl)-1H-benzimidazol-2-yl]phenyl]furan-2-yl]aniline (PubChem CID 3007937) has the molecular formula C26H21N5O and a molecular weight of 419.49 g/mol. Its IUPAC name is 4-[5-[4-[6-(4,5-dihydro-1H-imidazol-2-yl)-1H-benzimidazol-2-yl]phenyl]furan-2-yl]aniline.
| Compound Name | 4-[5-[4-[6-(4,5-dihydro-1H-imidazol-2-yl)-1H-benzimidazol-2-yl]phenyl]furan-2-yl]aniline |
|---|---|
| PubChem CID | 3007937 |
| Molecular Formula | C26H21N5O |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | 4-[5-[4-[6-(4,5-dihydro-1H-imidazol-2-yl)-1H-benzimidazol-2-yl]phenyl]furan-2-yl]aniline |
| SMILES | Nc1ccc(-c2ccc(-c3ccc(-c4nc5ccc(C6=NCCN6)cc5[nH]4)cc3)o2)cc1 |
| InChI | InChI=1S/C26H21N5O/c27-20-8-5-17(6-9-20)24-12-11-23(32-24)16-1-3-18(4-2-16)26-30-21-10-7-19(15-22(21)31-26)25-28-13-14-29-25/h1-12,15H,13-14,27H2,(H,28,29)(H,30,31) |
| InChIKey | FPZPLIHUAYTLEW-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 92.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|