C26H46O2Si2 — CID 141353569
tris(prop-2-enyl)-[1-tris(prop-2-enyl)silyloxyoctan-4-yloxy]silane (PubChem CID 141353569) has the molecular formula C26H46O2Si2 and a molecular weight of 446.82 g/mol. Its IUPAC name is tris(prop-2-enyl)-[1-tris(prop-2-enyl)silyloxyoctan-4-yloxy]silane.
| Compound Name | tris(prop-2-enyl)-[1-tris(prop-2-enyl)silyloxyoctan-4-yloxy]silane |
|---|---|
| PubChem CID | 141353569 |
| Molecular Formula | C26H46O2Si2 |
| Molecular Weight | 446.82 g/mol |
| Exact Mass | 446.30 |
| IUPAC Name | tris(prop-2-enyl)-[1-tris(prop-2-enyl)silyloxyoctan-4-yloxy]silane |
| SMILES | C=CC[Si](CC=C)(CC=C)OCCCC(CCCC)O[Si](CC=C)(CC=C)CC=C |
| InChI | InChI=1S/C26H46O2Si2/c1-8-15-17-26(28-30(23-12-5,24-13-6)25-14-7)18-16-19-27-29(20-9-2,21-10-3)22-11-4/h9-14,26H,2-8,15-25H2,1H3 |
| InChIKey | QZQYZQAUAWWJAJ-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.82 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|