C24H42O2Si2 — CID 134977934
tert-butyl-[(4Z)-8-[tert-butyl(dimethyl)silyl]oxycyclododec-4-en-2,6-diyn-1-yl]oxy-dimethylsilane (PubChem CID 134977934) has the molecular formula C24H42O2Si2 and a molecular weight of 418.77 g/mol. Its IUPAC name is tert-butyl-[(4Z)-8-[tert-butyl(dimethyl)silyl]oxycyclododec-4-en-2,6-diyn-1-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(4Z)-8-[tert-butyl(dimethyl)silyl]oxycyclododec-4-en-2,6-diyn-1-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 134977934 |
| Molecular Formula | C24H42O2Si2 |
| Molecular Weight | 418.77 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | tert-butyl-[(4Z)-8-[tert-butyl(dimethyl)silyl]oxycyclododec-4-en-2,6-diyn-1-yl]oxy-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC1C#C/C=C\C#CC(O[Si](C)(C)C(C)(C)C)CCCC1 |
| InChI | InChI=1S/C24H42O2Si2/c1-23(2,3)27(7,8)25-21-17-13-11-12-14-18-22(20-16-15-19-21)26-28(9,10)24(4,5)6/h11-12,21-22H,15-16,19-20H2,1-10H3/b12-11- |
| InChIKey | CDXRWTLNUCMIRE-QXMHVHEDSA-N |
| XLogP | 6.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.77 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|