C23H46OSi2 — CID 11858913
tert-butyl-dimethyl-[(4R)-1-trimethylsilyltetradec-13-en-1-yn-4-yl]oxysilane (PubChem CID 11858913) has the molecular formula C23H46OSi2 and a molecular weight of 394.79 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(4R)-1-trimethylsilyltetradec-13-en-1-yn-4-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(4R)-1-trimethylsilyltetradec-13-en-1-yn-4-yl]oxysilane |
|---|---|
| PubChem CID | 11858913 |
| Molecular Formula | C23H46OSi2 |
| Molecular Weight | 394.79 g/mol |
| Exact Mass | 394.31 |
| IUPAC Name | tert-butyl-dimethyl-[(4R)-1-trimethylsilyltetradec-13-en-1-yn-4-yl]oxysilane |
| SMILES | C=CCCCCCCCC[C@H](CC#C[Si](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H46OSi2/c1-10-11-12-13-14-15-16-17-19-22(20-18-21-25(5,6)7)24-26(8,9)23(2,3)4/h10,22H,1,11-17,19-20H2,2-9H3/t22-/m1/s1 |
| InChIKey | ZLRZKTGOOMCMSE-JOCHJYFZSA-N |
| XLogP | 7.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.79 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|