C11H20O7S — CID 141355025
(4R,5S,6S,7R)-4,5,6,7,8-pentahydroxy-1-propan-2-ylsulfanyloctane-2,3-dione (PubChem CID 141355025) has the molecular formula C11H20O7S and a molecular weight of 296.34 g/mol. Its IUPAC name is (4R,5S,6S,7R)-4,5,6,7,8-pentahydroxy-1-propan-2-ylsulfanyloctane-2,3-dione.
| Compound Name | (4R,5S,6S,7R)-4,5,6,7,8-pentahydroxy-1-propan-2-ylsulfanyloctane-2,3-dione |
|---|---|
| PubChem CID | 141355025 |
| Molecular Formula | C11H20O7S |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | (4R,5S,6S,7R)-4,5,6,7,8-pentahydroxy-1-propan-2-ylsulfanyloctane-2,3-dione |
| SMILES | CC(C)SCC(=O)C(=O)[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C11H20O7S/c1-5(2)19-4-7(14)9(16)11(18)10(17)8(15)6(13)3-12/h5-6,8,10-13,15,17-18H,3-4H2,1-2H3/t6-,8+,10+,11+/m1/s1 |
| InChIKey | YIUVHEYCPWLXPQ-PFSJRZQVSA-N |
| XLogP | -2.30 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|