C19H22N2O2 — CID 141356064
4,5-diamino-2-(2-methoxy-4-propan-2-ylphenyl)inden-2-ol (PubChem CID 141356064) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is 4,5-diamino-2-(2-methoxy-4-propan-2-ylphenyl)inden-2-ol.
| Compound Name | 4,5-diamino-2-(2-methoxy-4-propan-2-ylphenyl)inden-2-ol |
|---|---|
| PubChem CID | 141356064 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 4,5-diamino-2-(2-methoxy-4-propan-2-ylphenyl)inden-2-ol |
| SMILES | COc1cc(C(C)C)ccc1C1(O)C=c2ccc(N)c(N)c2=C1 |
| InChI | InChI=1S/C19H22N2O2/c1-11(2)12-4-6-15(17(8-12)23-3)19(22)9-13-5-7-16(20)18(21)14(13)10-19/h4-11,22H,20-21H2,1-3H3 |
| InChIKey | JKJDMPUCEBUICI-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|