C22H23NO5 — CID 71477447
ethyl N-[2-(2-methoxy-4-propan-2-ylphenyl)-1,3-dioxoinden-2-yl]carbamate (PubChem CID 71477447) has the molecular formula C22H23NO5 and a molecular weight of 381.43 g/mol. Its IUPAC name is ethyl N-[2-(2-methoxy-4-propan-2-ylphenyl)-1,3-dioxoinden-2-yl]carbamate.
| Compound Name | ethyl N-[2-(2-methoxy-4-propan-2-ylphenyl)-1,3-dioxoinden-2-yl]carbamate |
|---|---|
| PubChem CID | 71477447 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | ethyl N-[2-(2-methoxy-4-propan-2-ylphenyl)-1,3-dioxoinden-2-yl]carbamate |
| SMILES | CCOC(=O)NC1(c2ccc(C(C)C)cc2OC)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H23NO5/c1-5-28-21(26)23-22(17-11-10-14(13(2)3)12-18(17)27-4)19(24)15-8-6-7-9-16(15)20(22)25/h6-13H,5H2,1-4H3,(H,23,26) |
| InChIKey | NVCWYLPWQVTQRA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|