C27H23NO6 — CID 71478171
[2-(2-acetamido-1,3-dioxoinden-2-yl)-5-propan-2-ylphenyl] phenyl carbonate (PubChem CID 71478171) has the molecular formula C27H23NO6 and a molecular weight of 457.48 g/mol. Its IUPAC name is [2-(2-acetamido-1,3-dioxoinden-2-yl)-5-propan-2-ylphenyl] phenyl carbonate.
| Compound Name | [2-(2-acetamido-1,3-dioxoinden-2-yl)-5-propan-2-ylphenyl] phenyl carbonate |
|---|---|
| PubChem CID | 71478171 |
| Molecular Formula | C27H23NO6 |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | [2-(2-acetamido-1,3-dioxoinden-2-yl)-5-propan-2-ylphenyl] phenyl carbonate |
| SMILES | CC(=O)NC1(c2ccc(C(C)C)cc2OC(=O)Oc2ccccc2)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C27H23NO6/c1-16(2)18-13-14-22(23(15-18)34-26(32)33-19-9-5-4-6-10-19)27(28-17(3)29)24(30)20-11-7-8-12-21(20)25(27)31/h4-16H,1-3H3,(H,28,29) |
| InChIKey | BSBQCHVKBYLRJL-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|