C22H23NO6 — CID 138714280
[2-(2-acetamido-1,3-dioxo-5,6-dihydroinden-2-yl)-5-propan-2-ylphenyl] methyl carbonate (PubChem CID 138714280) has the molecular formula C22H23NO6 and a molecular weight of 397.43 g/mol. Its IUPAC name is [2-(2-acetamido-1,3-dioxo-5,6-dihydroinden-2-yl)-5-propan-2-ylphenyl] methyl carbonate.
| Compound Name | [2-(2-acetamido-1,3-dioxo-5,6-dihydroinden-2-yl)-5-propan-2-ylphenyl] methyl carbonate |
|---|---|
| PubChem CID | 138714280 |
| Molecular Formula | C22H23NO6 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | [2-(2-acetamido-1,3-dioxo-5,6-dihydroinden-2-yl)-5-propan-2-ylphenyl] methyl carbonate |
| SMILES | COC(=O)Oc1cc(C(C)C)ccc1C1(NC(C)=O)C(=O)C2=CCCC=C2C1=O |
| InChI | InChI=1S/C22H23NO6/c1-12(2)14-9-10-17(18(11-14)29-21(27)28-4)22(23-13(3)24)19(25)15-7-5-6-8-16(15)20(22)26/h7-12H,5-6H2,1-4H3,(H,23,24) |
| InChIKey | SHSXSGSAUXJECK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|